C26H40N2O6 — CID 90376364
[3-hexyl-5-hydroxy-4-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-6-yl)phenyl] 5-nitrooxypentanoate (PubChem CID 90376364) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is [3-hexyl-5-hydroxy-4-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-6-yl)phenyl] 5-nitrooxypentanoate.
| Compound Name | [3-hexyl-5-hydroxy-4-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-6-yl)phenyl] 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 90376364 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | [3-hexyl-5-hydroxy-4-(4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridin-6-yl)phenyl] 5-nitrooxypentanoate |
| SMILES | CCCCCCc1cc(OC(=O)CCCCO[N+](=O)[O-])cc(O)c1C1C=C(C)CCN1C(C)C |
| InChI | InChI=1S/C26H40N2O6/c1-5-6-7-8-11-21-17-22(34-25(30)12-9-10-15-33-28(31)32)18-24(29)26(21)23-16-20(4)13-14-27(23)19(2)3/h16-19,23,29H,5-15H2,1-4H3 |
| InChIKey | STEGRDLAMTXBJC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|