C28H24FIN2O — CID 166780137
4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexane-1-carbonitrile (PubChem CID 166780137) has the molecular formula C28H24FIN2O and a molecular weight of 550.42 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 166780137 |
| Molecular Formula | C28H24FIN2O |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-3-iodo-4-phenylmethoxyindol-2-yl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(c2c(I)c3c(OCc4ccccc4)cccc3n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H24FIN2O/c29-22-13-15-23(16-14-22)32-24-7-4-8-25(33-18-20-5-2-1-3-6-20)26(24)27(30)28(32)21-11-9-19(17-31)10-12-21/h1-8,13-16,19,21H,9-12,18H2 |
| InChIKey | IDAOUIYXKWYHNO-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|