C29H23FN2O — CID 156879211
4-[2-cyclobutyl-4-cyclopropyl-1-(4-fluorophenyl)indol-3-yl]benzoyl cyanide (PubChem CID 156879211) has the molecular formula C29H23FN2O and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-[2-cyclobutyl-4-cyclopropyl-1-(4-fluorophenyl)indol-3-yl]benzoyl cyanide.
| Compound Name | 4-[2-cyclobutyl-4-cyclopropyl-1-(4-fluorophenyl)indol-3-yl]benzoyl cyanide |
|---|---|
| PubChem CID | 156879211 |
| Molecular Formula | C29H23FN2O |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[2-cyclobutyl-4-cyclopropyl-1-(4-fluorophenyl)indol-3-yl]benzoyl cyanide |
| SMILES | N#CC(=O)c1ccc(-c2c(C3CCC3)n(-c3ccc(F)cc3)c3cccc(C4CC4)c23)cc1 |
| InChI | InChI=1S/C29H23FN2O/c30-22-13-15-23(16-14-22)32-25-6-2-5-24(18-7-8-18)28(25)27(29(32)21-3-1-4-21)20-11-9-19(10-12-20)26(33)17-31/h2,5-6,9-16,18,21H,1,3-4,7-8H2 |
| InChIKey | XYOUNVXXQWMJTM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|