C28H27FN2O5S — CID 156878689
4-[2-(1-ethylsulfonylpiperidin-3-yl)-1-(4-fluorophenyl)-4-hydroxyindol-3-yl]benzoic acid (PubChem CID 156878689) has the molecular formula C28H27FN2O5S and a molecular weight of 522.60 g/mol. Its IUPAC name is 4-[2-(1-ethylsulfonylpiperidin-3-yl)-1-(4-fluorophenyl)-4-hydroxyindol-3-yl]benzoic acid.
| Compound Name | 4-[2-(1-ethylsulfonylpiperidin-3-yl)-1-(4-fluorophenyl)-4-hydroxyindol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 156878689 |
| Molecular Formula | C28H27FN2O5S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 4-[2-(1-ethylsulfonylpiperidin-3-yl)-1-(4-fluorophenyl)-4-hydroxyindol-3-yl]benzoic acid |
| SMILES | CCS(=O)(=O)N1CCCC(c2c(-c3ccc(C(=O)O)cc3)c3c(O)cccc3n2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C28H27FN2O5S/c1-2-37(35,36)30-16-4-5-20(17-30)27-25(18-8-10-19(11-9-18)28(33)34)26-23(6-3-7-24(26)32)31(27)22-14-12-21(29)13-15-22/h3,6-15,20,32H,2,4-5,16-17H2,1H3,(H,33,34) |
| InChIKey | YOBAMHGRTJWRTN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |