C29H30FNO4 — CID 156878639
ethane;4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-3-methylbenzoic acid (PubChem CID 156878639) has the molecular formula C29H30FNO4 and a molecular weight of 475.56 g/mol. Its IUPAC name is ethane;4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-3-methylbenzoic acid.
| Compound Name | ethane;4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 156878639 |
| Molecular Formula | C29H30FNO4 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | ethane;4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-3-methylbenzoic acid |
| SMILES | CC.Cc1cc(C(=O)O)ccc1-c1c(C2CCOCC2)n(-c2ccc(F)cc2)c2cccc(O)c12 |
| InChI | InChI=1S/C27H24FNO4.C2H6/c1-16-15-18(27(31)32)5-10-21(16)24-25-22(3-2-4-23(25)30)29(20-8-6-19(28)7-9-20)26(24)17-11-13-33-14-12-17;1-2/h2-10,15,17,30H,11-14H2,1H3,(H,31,32);1-2H3 |
| InChIKey | FIRFGTMBJTVUCR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |