C27H23F2NO4 — CID 156879214
3-fluoro-4-[1-(4-fluoro-3-methylphenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid (PubChem CID 156879214) has the molecular formula C27H23F2NO4 and a molecular weight of 463.48 g/mol. Its IUPAC name is 3-fluoro-4-[1-(4-fluoro-3-methylphenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid.
| Compound Name | 3-fluoro-4-[1-(4-fluoro-3-methylphenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 156879214 |
| Molecular Formula | C27H23F2NO4 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-fluoro-4-[1-(4-fluoro-3-methylphenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid |
| SMILES | Cc1cc(-n2c(C3CCOCC3)c(-c3ccc(C(=O)O)cc3F)c3c(O)cccc32)ccc1F |
| InChI | InChI=1S/C27H23F2NO4/c1-15-13-18(6-8-20(15)28)30-22-3-2-4-23(31)25(22)24(26(30)16-9-11-34-12-10-16)19-7-5-17(27(32)33)14-21(19)29/h2-8,13-14,16,31H,9-12H2,1H3,(H,32,33) |
| InChIKey | WYNWQCOMMYXFMZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |