C26H21F3N2O3 — CID 156878669
4-[1-(3,4-difluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzamide (PubChem CID 156878669) has the molecular formula C26H21F3N2O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 4-[1-(3,4-difluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzamide.
| Compound Name | 4-[1-(3,4-difluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 156878669 |
| Molecular Formula | C26H21F3N2O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[1-(3,4-difluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzamide |
| SMILES | NC(=O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)c(F)c3)c3cccc(O)c23)cc1F |
| InChI | InChI=1S/C26H21F3N2O3/c27-18-7-5-16(13-20(18)29)31-21-2-1-3-22(32)24(21)23(25(31)14-8-10-34-11-9-14)15-4-6-17(26(30)33)19(28)12-15/h1-7,12-14,32H,8-11H2,(H2,30,33) |
| InChIKey | FRGVWFXEPQNPNU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |