About 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid
4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid (PubChem CID 156878951) has the molecular formula C26H21F3NO7P
and a molecular weight of 547.42 g/mol. Its IUPAC name is 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid |
| PubChem CID | 156878951 |
| Molecular Formula | C26H21F3NO7P |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)c(F)c3)c3cc(F)cc(OP(=O)(O)O)c23)cc1 |
| InChI | InChI=1S/C26H21F3NO7P/c27-17-11-21-24(22(12-17)37-38(33,34)35)23(14-1-3-16(4-2-14)26(31)32)25(15-7-9-36-10-8-15)30(21)18-5-6-19(28)20(29)13-18/h1-6,11-13,15H,7-10H2,(H,31,32)(H2,33,34,35) |
| InChIKey | IWYOAACRQLXLSV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid?
The IUPAC name of 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid (CID 156878951) is 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid.
What is the SMILES notation for 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid?
The canonical SMILES for 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid is O=C(O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)c(F)c3)c3cc(F)cc(OP(=O)(O)O)c23)cc1.
What is the InChIKey of 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid?
The InChIKey is IWYOAACRQLXLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21F3NO7P/c27-17-11-21-24(22(12-17)37-38(33,34)35)23(14-1-3-16(4-2-14)26(31)32)25(15-7-9-36-10-8-15)30(21)18-5-6-19(28)20(29)13-18/h1-6,11-13,15H,7-10H2,(H,31,32)(H2,33,34,35).
What are the key properties of 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid?
4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid has a molecular weight of 547.42 g/mol, XLogP of 5.78, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-difluorophenyl)-6-fluoro-2-(oxan-4-yl)-4-phosphonooxyindol-3-yl]benzoic acid is sourced from PubChem (CID 156878951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).