C26H21F2NO4 — CID 156878299
3-fluoro-5-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid (PubChem CID 156878299) has the molecular formula C26H21F2NO4 and a molecular weight of 449.45 g/mol. Its IUPAC name is 3-fluoro-5-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid.
| Compound Name | 3-fluoro-5-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 156878299 |
| Molecular Formula | C26H21F2NO4 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-fluoro-5-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]benzoic acid |
| SMILES | O=C(O)c1cc(F)cc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cccc(O)c23)c1 |
| InChI | InChI=1S/C26H21F2NO4/c27-18-4-6-20(7-5-18)29-21-2-1-3-22(30)24(21)23(25(29)15-8-10-33-11-9-15)16-12-17(26(31)32)14-19(28)13-16/h1-7,12-15,30H,8-11H2,(H,31,32) |
| InChIKey | UXMPSSFVCGSVFV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |