C28H26F3NO2 — CID 156879230
1-[3-(difluoromethyl)-4-fluorophenyl]-3-methyl-2-(oxan-4-yl)-4-phenylmethoxyindole (PubChem CID 156879230) has the molecular formula C28H26F3NO2 and a molecular weight of 465.52 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-4-fluorophenyl]-3-methyl-2-(oxan-4-yl)-4-phenylmethoxyindole.
| Compound Name | 1-[3-(difluoromethyl)-4-fluorophenyl]-3-methyl-2-(oxan-4-yl)-4-phenylmethoxyindole |
|---|---|
| PubChem CID | 156879230 |
| Molecular Formula | C28H26F3NO2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 1-[3-(difluoromethyl)-4-fluorophenyl]-3-methyl-2-(oxan-4-yl)-4-phenylmethoxyindole |
| SMILES | Cc1c(C2CCOCC2)n(-c2ccc(F)c(C(F)F)c2)c2cccc(OCc3ccccc3)c12 |
| InChI | InChI=1S/C28H26F3NO2/c1-18-26-24(8-5-9-25(26)34-17-19-6-3-2-4-7-19)32(27(18)20-12-14-33-15-13-20)21-10-11-23(29)22(16-21)28(30)31/h2-11,16,20,28H,12-15,17H2,1H3 |
| InChIKey | XKDZXVMCVAWBCA-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |