C34H34FNO5 — CID 156877226
methyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]-1-formylcyclobutane-1-carboxylate (PubChem CID 156877226) has the molecular formula C34H34FNO5 and a molecular weight of 555.65 g/mol. Its IUPAC name is methyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]-1-formylcyclobutane-1-carboxylate.
| Compound Name | methyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]-1-formylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 156877226 |
| Molecular Formula | C34H34FNO5 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | methyl 3-[1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)-5-phenylmethoxyindol-3-yl]-1-formylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(C=O)CC(c2c(C3CCOCC3)n(-c3ccc(F)c(C)c3)c3ccc(OCc4ccccc4)cc23)C1 |
| InChI | InChI=1S/C34H34FNO5/c1-22-16-26(8-10-29(22)35)36-30-11-9-27(41-20-23-6-4-3-5-7-23)17-28(30)31(32(36)24-12-14-40-15-13-24)25-18-34(19-25,21-37)33(38)39-2/h3-11,16-17,21,24-25H,12-15,18-20H2,1-2H3 |
| InChIKey | CXJOYKYHDHNQHG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|