C28H25F2NO4 — CID 156879001
4-[5-fluoro-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]-2-methoxybenzoic acid (PubChem CID 156879001) has the molecular formula C28H25F2NO4 and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-[5-fluoro-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]-2-methoxybenzoic acid.
| Compound Name | 4-[5-fluoro-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 156879001 |
| Molecular Formula | C28H25F2NO4 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 4-[5-fluoro-1-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-3-yl]-2-methoxybenzoic acid |
| SMILES | COc1cc(-c2c(C3CCOCC3)n(-c3ccc(F)c(C)c3)c3ccc(F)cc23)ccc1C(=O)O |
| InChI | InChI=1S/C28H25F2NO4/c1-16-13-20(5-7-23(16)30)31-24-8-4-19(29)15-22(24)26(27(31)17-9-11-35-12-10-17)18-3-6-21(28(32)33)25(14-18)34-2/h3-8,13-15,17H,9-12H2,1-2H3,(H,32,33) |
| InChIKey | COOIBRWLBVBUQN-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |