C27H23F3N2O3 — CID 168755136
4-[7-amino-5,6-difluoro-3-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-1-yl]benzoic acid (PubChem CID 168755136) has the molecular formula C27H23F3N2O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 4-[7-amino-5,6-difluoro-3-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-1-yl]benzoic acid.
| Compound Name | 4-[7-amino-5,6-difluoro-3-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 168755136 |
| Molecular Formula | C27H23F3N2O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-[7-amino-5,6-difluoro-3-(4-fluoro-3-methylphenyl)-2-(oxan-4-yl)indol-1-yl]benzoic acid |
| SMILES | Cc1cc(-c2c(C3CCOCC3)n(-c3ccc(C(=O)O)cc3)c3c(N)c(F)c(F)cc23)ccc1F |
| InChI | InChI=1S/C27H23F3N2O3/c1-14-12-17(4-7-20(14)28)22-19-13-21(29)23(30)24(31)26(19)32(25(22)15-8-10-35-11-9-15)18-5-2-16(3-6-18)27(33)34/h2-7,12-13,15H,8-11,31H2,1H3,(H,33,34) |
| InChIKey | ARSLAPDDNBPUOT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|