C30H32FN3O3 — CID 155734535
ethane;4-[1-(4-fluorophenyl)-6-methanimidoyl-5-(methylamino)-2-(oxan-4-yl)indol-3-yl]benzoic acid (PubChem CID 155734535) has the molecular formula C30H32FN3O3 and a molecular weight of 501.60 g/mol. Its IUPAC name is ethane;4-[1-(4-fluorophenyl)-6-methanimidoyl-5-(methylamino)-2-(oxan-4-yl)indol-3-yl]benzoic acid.
| Compound Name | ethane;4-[1-(4-fluorophenyl)-6-methanimidoyl-5-(methylamino)-2-(oxan-4-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155734535 |
| Molecular Formula | C30H32FN3O3 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | ethane;4-[1-(4-fluorophenyl)-6-methanimidoyl-5-(methylamino)-2-(oxan-4-yl)indol-3-yl]benzoic acid |
| SMILES | CC.[H]/N=C/c1cc2c(cc1NC)c(-c1ccc(C(=O)O)cc1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H26FN3O3.C2H6/c1-31-24-15-23-25(14-20(24)16-30)32(22-8-6-21(29)7-9-22)27(18-10-12-35-13-11-18)26(23)17-2-4-19(5-3-17)28(33)34;1-2/h2-9,14-16,18,30-31H,10-13H2,1H3,(H,33,34);1-2H3/b30-16+; |
| InChIKey | KVROAADPJOYCNX-IGNXELRDSA-N |
| XLogP | 7.09 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|