C26H24FN3O2 — CID 155734566
4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]phenol (PubChem CID 155734566) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]phenol.
| Compound Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]phenol |
|---|---|
| PubChem CID | 155734566 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]phenol |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1ccc(O)cc1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3O2/c27-19-3-5-20(6-4-19)30-24-13-18(15-28)23(29)14-22(24)25(16-1-7-21(31)8-2-16)26(30)17-9-11-32-12-10-17/h1-8,13-15,17,28,31H,9-12,29H2/b28-15+ |
| InChIKey | DZLXPVWJQKIPDD-RWPZCVJISA-N |
| XLogP | 5.62 |
| TPSA | 84.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|