C27H26FN3O4S — CID 155734580
4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(2-methyl-1-methylsulfonylpropan-2-yl)indol-3-yl]benzoic acid (PubChem CID 155734580) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(2-methyl-1-methylsulfonylpropan-2-yl)indol-3-yl]benzoic acid.
| Compound Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(2-methyl-1-methylsulfonylpropan-2-yl)indol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155734580 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(2-methyl-1-methylsulfonylpropan-2-yl)indol-3-yl]benzoic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)cc1)c(C(C)(C)CS(C)(=O)=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FN3O4S/c1-27(2,15-36(3,34)35)25-24(16-4-6-17(7-5-16)26(32)33)21-13-22(30)18(14-29)12-23(21)31(25)20-10-8-19(28)9-11-20/h4-14,29H,15,30H2,1-3H3,(H,32,33)/b29-14+ |
| InChIKey | UPYSPKAQKJRSNQ-IPPBACCNSA-N |
| XLogP | 5.04 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|