C28H29FN5P — CID 155734424
3-[5-amino-3-(6-dimethylphosphanyl-4-methyl-3-pyridinyl)-1-(4-fluorophenyl)-6-methanimidoylindol-2-yl]-3-methylbutanenitrile (PubChem CID 155734424) has the molecular formula C28H29FN5P and a molecular weight of 485.55 g/mol. Its IUPAC name is 3-[5-amino-3-(6-dimethylphosphanyl-4-methyl-3-pyridinyl)-1-(4-fluorophenyl)-6-methanimidoylindol-2-yl]-3-methylbutanenitrile.
| Compound Name | 3-[5-amino-3-(6-dimethylphosphanyl-4-methyl-3-pyridinyl)-1-(4-fluorophenyl)-6-methanimidoylindol-2-yl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 155734424 |
| Molecular Formula | C28H29FN5P |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 3-[5-amino-3-(6-dimethylphosphanyl-4-methyl-3-pyridinyl)-1-(4-fluorophenyl)-6-methanimidoylindol-2-yl]-3-methylbutanenitrile |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1cnc(P(C)C)cc1C)c(C(C)(C)CC#N)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H29FN5P/c1-17-12-25(35(4)5)33-16-22(17)26-21-14-23(32)18(15-31)13-24(21)34(20-8-6-19(29)7-9-20)27(26)28(2,3)10-11-30/h6-9,12-16,31H,10,32H2,1-5H3/b31-15+ |
| InChIKey | IYSIDTNKLOZYAW-IBBHUPRXSA-N |
| XLogP | 6.28 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|