C30H34F2N4O3 — CID 155734813
5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-3-fluoropyridine-2-carboxylic acid;ethane (PubChem CID 155734813) has the molecular formula C30H34F2N4O3 and a molecular weight of 536.62 g/mol. Its IUPAC name is 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-3-fluoropyridine-2-carboxylic acid;ethane.
| Compound Name | 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-3-fluoropyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 155734813 |
| Molecular Formula | C30H34F2N4O3 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-3-fluoropyridine-2-carboxylic acid;ethane |
| SMILES | CC.CC.[H]/N=C/c1cc2c(cc1N)c(-c1cnc(C(=O)O)c(F)c1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H22F2N4O3.2C2H6/c27-17-1-3-18(4-2-17)32-22-10-15(12-29)21(30)11-19(22)23(25(32)14-5-7-35-8-6-14)16-9-20(28)24(26(33)34)31-13-16;2*1-2/h1-4,9-14,29H,5-8,30H2,(H,33,34);2*1-2H3/b29-12+;; |
| InChIKey | ZBBXURZHPDBUDR-RNBRVUPWSA-N |
| XLogP | 7.20 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|