C29H25FN4O3 — CID 155734588
4-[5-amino-6-ethanimidoyl-1-(4-fluorophenyl)-2-(oxan-4-yl)indol-3-yl]-3-cyanobenzoic acid (PubChem CID 155734588) has the molecular formula C29H25FN4O3 and a molecular weight of 496.54 g/mol. Its IUPAC name is 4-[5-amino-6-ethanimidoyl-1-(4-fluorophenyl)-2-(oxan-4-yl)indol-3-yl]-3-cyanobenzoic acid.
| Compound Name | 4-[5-amino-6-ethanimidoyl-1-(4-fluorophenyl)-2-(oxan-4-yl)indol-3-yl]-3-cyanobenzoic acid |
|---|---|
| PubChem CID | 155734588 |
| Molecular Formula | C29H25FN4O3 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[5-amino-6-ethanimidoyl-1-(4-fluorophenyl)-2-(oxan-4-yl)indol-3-yl]-3-cyanobenzoic acid |
| SMILES | [H]/N=C(\C)c1cc2c(cc1N)c(-c1ccc(C(=O)O)cc1C#N)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H25FN4O3/c1-16(32)23-14-26-24(13-25(23)33)27(22-7-2-18(29(35)36)12-19(22)15-31)28(17-8-10-37-11-9-17)34(26)21-5-3-20(30)4-6-21/h2-7,12-14,17,32H,8-11,33H2,1H3,(H,35,36)/b32-16+ |
| InChIKey | SZWBDDVVTCTHLE-KPGMTVGESA-N |
| XLogP | 5.87 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|