C29H29F2N3O3 — CID 155734444
4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzoic acid;ethane (PubChem CID 155734444) has the molecular formula C29H29F2N3O3 and a molecular weight of 505.57 g/mol. Its IUPAC name is 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzoic acid;ethane.
| Compound Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzoic acid;ethane |
|---|---|
| PubChem CID | 155734444 |
| Molecular Formula | C29H29F2N3O3 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-fluorobenzoic acid;ethane |
| SMILES | CC.[H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)c(F)c1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23F2N3O3.C2H6/c28-18-2-4-19(5-3-18)32-24-12-17(14-30)23(31)13-21(24)25(26(32)15-7-9-35-10-8-15)16-1-6-20(27(33)34)22(29)11-16;1-2/h1-6,11-15,30H,7-10,31H2,(H,33,34);1-2H3/b30-14+; |
| InChIKey | ZWHAXULXYXVIOM-BGOJXXKFSA-N |
| XLogP | 6.77 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|