C25H23FN4O2 — CID 155734401
4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-1H-pyridin-2-one (PubChem CID 155734401) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-1H-pyridin-2-one.
| Compound Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 155734401 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-1H-pyridin-2-one |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1cc[nH]c(=O)c1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23FN4O2/c26-18-1-3-19(4-2-18)30-22-11-17(14-27)21(28)13-20(22)24(16-5-8-29-23(31)12-16)25(30)15-6-9-32-10-7-15/h1-5,8,11-15,27H,6-7,9-10,28H2,(H,29,31)/b27-14+ |
| InChIKey | DQUZAWSDDPKJFM-MZJWZYIUSA-N |
| XLogP | 4.60 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|