C31H34FN5O2 — CID 155734438
1-[5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-pyridinyl]pyrrolidin-2-one;ethane (PubChem CID 155734438) has the molecular formula C31H34FN5O2 and a molecular weight of 527.64 g/mol. Its IUPAC name is 1-[5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-pyridinyl]pyrrolidin-2-one;ethane.
| Compound Name | 1-[5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-pyridinyl]pyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 155734438 |
| Molecular Formula | C31H34FN5O2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 1-[5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-3-yl]-2-pyridinyl]pyrrolidin-2-one;ethane |
| SMILES | CC.[H]/N=C/c1cc2c(cc1N)c(-c1ccc(N3CCCC3=O)nc1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H28FN5O2.C2H6/c30-21-4-6-22(7-5-21)35-25-14-20(16-31)24(32)15-23(25)28(29(35)18-9-12-37-13-10-18)19-3-8-26(33-17-19)34-11-1-2-27(34)36;1-2/h3-8,14-18,31H,1-2,9-13,32H2;1-2H3/b31-16+; |
| InChIKey | ZWZCAUUAOXCGNM-IILCOTAFSA-N |
| XLogP | 6.46 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|