C28H28FN3O3 — CID 155734468
3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-amine (PubChem CID 155734468) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-amine.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-amine |
|---|---|
| PubChem CID | 155734468 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-amine |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1cc(OC)cc(OC)c1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28FN3O3/c1-33-22-11-18(12-23(14-22)34-2)27-24-15-25(31)19(16-30)13-26(24)32(21-5-3-20(29)4-6-21)28(27)17-7-9-35-10-8-17/h3-6,11-17,30H,7-10,31H2,1-2H3/b30-16+ |
| InChIKey | BZUXUNWZBMLZAO-OKCVXOCRSA-N |
| XLogP | 5.93 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|