C26H24FN3O3 — CID 155734388
3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-2-methoxybenzoic acid (PubChem CID 155734388) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-2-methoxybenzoic acid.
| Compound Name | 3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 155734388 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-2-methoxybenzoic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1cccc(C(=O)O)c1OC)c(C(C)C)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3O3/c1-14(2)24-23(18-5-4-6-19(26(31)32)25(18)33-3)20-12-21(29)15(13-28)11-22(20)30(24)17-9-7-16(27)8-10-17/h4-14,28H,29H2,1-3H3,(H,31,32)/b28-13+ |
| InChIKey | ZLERNIFMNYMKKT-XODNFHPESA-N |
| XLogP | 5.85 |
| TPSA | 101.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|