C27H29FN4O2 — CID 155734765
5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-6-methylpyridine-2-carboxylic acid;ethane (PubChem CID 155734765) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-6-methylpyridine-2-carboxylic acid;ethane.
| Compound Name | 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-6-methylpyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 155734765 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 5-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]-6-methylpyridine-2-carboxylic acid;ethane |
| SMILES | CC.[H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)nc1C)c(C(C)C)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H23FN4O2.C2H6/c1-13(2)24-23(18-8-9-21(25(31)32)29-14(18)3)19-11-20(28)15(12-27)10-22(19)30(24)17-6-4-16(26)5-7-17;1-2/h4-13,27H,28H2,1-3H3,(H,31,32);1-2H3/b27-12+; |
| InChIKey | PBIRKUATYKIOMC-ZZSMSKJWSA-N |
| XLogP | 6.57 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|