C27H24FN5O3 — CID 155734892
5-[5-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]-6-methoxypyridine-2-carboxylic acid (PubChem CID 155734892) has the molecular formula C27H24FN5O3 and a molecular weight of 485.52 g/mol. Its IUPAC name is 5-[5-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]-6-methoxypyridine-2-carboxylic acid.
| Compound Name | 5-[5-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]-6-methoxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155734892 |
| Molecular Formula | C27H24FN5O3 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 5-[5-amino-2-(1-cyano-2-methylpropan-2-yl)-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]-6-methoxypyridine-2-carboxylic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)nc1OC)c(C(C)(C)CC#N)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H24FN5O3/c1-27(2,10-11-29)24-23(18-8-9-21(26(34)35)32-25(18)36-3)19-13-20(31)15(14-30)12-22(19)33(24)17-6-4-16(28)5-7-17/h4-9,12-14,30H,10,31H2,1-3H3,(H,34,35)/b30-14+ |
| InChIKey | BNKSRIUNGLYXET-AMVVHIIESA-N |
| XLogP | 5.31 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|