C25H23F2N3O2 — CID 155734836
4-[5-amino-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]-3-fluorobenzoic acid;ethane (PubChem CID 155734836) has the molecular formula C25H23F2N3O2 and a molecular weight of 435.47 g/mol. Its IUPAC name is 4-[5-amino-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]-3-fluorobenzoic acid;ethane.
| Compound Name | 4-[5-amino-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]-3-fluorobenzoic acid;ethane |
|---|---|
| PubChem CID | 155734836 |
| Molecular Formula | C25H23F2N3O2 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 4-[5-amino-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]-3-fluorobenzoic acid;ethane |
| SMILES | CC.[H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)cc1F)c(C)n2-c1cccc(F)c1 |
| InChI | InChI=1S/C23H17F2N3O2.C2H6/c1-12-22(17-6-5-13(23(29)30)7-19(17)25)18-10-20(27)14(11-26)8-21(18)28(12)16-4-2-3-15(24)9-16;1-2/h2-11,26H,27H2,1H3,(H,29,30);1-2H3/b26-11+; |
| InChIKey | MAUKUBSMACPZLJ-GRLWOBSZSA-N |
| XLogP | 6.19 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|