C29H28FN3O3 — CID 155734631
methyl 4-[5-(2,2-dimethylpropanoylamino)-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]benzoate (PubChem CID 155734631) has the molecular formula C29H28FN3O3 and a molecular weight of 485.56 g/mol. Its IUPAC name is methyl 4-[5-(2,2-dimethylpropanoylamino)-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]benzoate.
| Compound Name | methyl 4-[5-(2,2-dimethylpropanoylamino)-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]benzoate |
|---|---|
| PubChem CID | 155734631 |
| Molecular Formula | C29H28FN3O3 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | methyl 4-[5-(2,2-dimethylpropanoylamino)-1-(3-fluorophenyl)-6-methanimidoyl-2-methylindol-3-yl]benzoate |
| SMILES | [H]/N=C/c1cc2c(cc1NC(=O)C(C)(C)C)c(-c1ccc(C(=O)OC)cc1)c(C)n2-c1cccc(F)c1 |
| InChI | InChI=1S/C29H28FN3O3/c1-17-26(18-9-11-19(12-10-18)27(34)36-5)23-15-24(32-28(35)29(2,3)4)20(16-31)13-25(23)33(17)22-8-6-7-21(30)14-22/h6-16,31H,1-5H3,(H,32,35)/b31-16+ |
| InChIKey | MULDSHPDMNSHGR-WCMJOSRZSA-N |
| XLogP | 6.51 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|