C23H26FN3O — CID 155734587
N-[1-(2-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-5-yl]-2,2-dimethylpropanamide (PubChem CID 155734587) has the molecular formula C23H26FN3O and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-5-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-(2-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-5-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155734587 |
| Molecular Formula | C23H26FN3O |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[1-(2-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-5-yl]-2,2-dimethylpropanamide |
| SMILES | [H]/N=C/c1cc2c(cc1NC(=O)C(C)(C)C)cc(C(C)C)n2-c1ccccc1F |
| InChI | InChI=1S/C23H26FN3O/c1-14(2)20-11-15-10-18(26-22(28)23(3,4)5)16(13-25)12-21(15)27(20)19-9-7-6-8-17(19)24/h6-14,25H,1-5H3,(H,26,28)/b25-13+ |
| InChIKey | HKNKHWGMKZURDM-DHRITJCHSA-N |
| XLogP | 5.88 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|