C18H17BrF3N3O — CID 171072319
N-[3-bromo-4-(3,4-difluoroanilino)-2-fluoro-6-methanimidoylphenyl]-2,2-dimethylpropanamide (PubChem CID 171072319) has the molecular formula C18H17BrF3N3O and a molecular weight of 428.25 g/mol. Its IUPAC name is N-[3-bromo-4-(3,4-difluoroanilino)-2-fluoro-6-methanimidoylphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-bromo-4-(3,4-difluoroanilino)-2-fluoro-6-methanimidoylphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 171072319 |
| Molecular Formula | C18H17BrF3N3O |
| Molecular Weight | 428.25 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-[3-bromo-4-(3,4-difluoroanilino)-2-fluoro-6-methanimidoylphenyl]-2,2-dimethylpropanamide |
| SMILES | [H]/N=C/c1cc(Nc2ccc(F)c(F)c2)c(Br)c(F)c1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H17BrF3N3O/c1-18(2,3)17(26)25-16-9(8-23)6-13(14(19)15(16)22)24-10-4-5-11(20)12(21)7-10/h4-8,23-24H,1-3H3,(H,25,26)/b23-8+ |
| InChIKey | RGKHSYCPYPHEMY-LIMNOBDPSA-N |
| XLogP | 5.59 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.25 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|