C13H11BrF2N3P — CID 177325842
2-bromo-1-N-(3,4-difluorophenyl)-5-methanimidoyl-3-phosphanylbenzene-1,4-diamine (PubChem CID 177325842) has the molecular formula C13H11BrF2N3P and a molecular weight of 358.13 g/mol. Its IUPAC name is 2-bromo-1-N-(3,4-difluorophenyl)-5-methanimidoyl-3-phosphanylbenzene-1,4-diamine.
| Compound Name | 2-bromo-1-N-(3,4-difluorophenyl)-5-methanimidoyl-3-phosphanylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 177325842 |
| Molecular Formula | C13H11BrF2N3P |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 2-bromo-1-N-(3,4-difluorophenyl)-5-methanimidoyl-3-phosphanylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2ccc(F)c(F)c2)c(Br)c(P)c1N |
| InChI | InChI=1S/C13H11BrF2N3P/c14-11-10(3-6(5-17)12(18)13(11)20)19-7-1-2-8(15)9(16)4-7/h1-5,17,19H,18,20H2/b17-5+ |
| InChIKey | UCYPIHRKEOJSOM-YAXRCOADSA-N |
| XLogP | 3.55 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|