C15H10BrF2N3 — CID 106948962
3-bromo-8-N-(3,4-difluorophenyl)quinoline-5,8-diamine (PubChem CID 106948962) has the molecular formula C15H10BrF2N3 and a molecular weight of 350.17 g/mol. Its IUPAC name is 3-bromo-8-N-(3,4-difluorophenyl)quinoline-5,8-diamine.
| Compound Name | 3-bromo-8-N-(3,4-difluorophenyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 106948962 |
| Molecular Formula | C15H10BrF2N3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 3-bromo-8-N-(3,4-difluorophenyl)quinoline-5,8-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)c(F)c2)c2ncc(Br)cc12 |
| InChI | InChI=1S/C15H10BrF2N3/c16-8-5-10-13(19)3-4-14(15(10)20-7-8)21-9-1-2-11(17)12(18)6-9/h1-7,21H,19H2 |
| InChIKey | IKOFXZAOJJSTHH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|