About 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine
6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine (PubChem CID 43621240) has the molecular formula C15H10BrF2N3
and a molecular weight of 350.17 g/mol. Its IUPAC name is 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine.
Molecular Properties
| Compound Name | 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine |
| PubChem CID | 43621240 |
| Molecular Formula | C15H10BrF2N3 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccc(Br)cc2c1Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H10BrF2N3/c16-8-1-4-14-10(5-8)15(13(19)7-20-14)21-9-2-3-11(17)12(18)6-9/h1-7H,19H2,(H,20,21) |
| InChIKey | BSNOZKOXKDKLFV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine?
The IUPAC name of 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine (CID 43621240) is 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine.
What is the SMILES notation for 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine?
The canonical SMILES for 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine is Nc1cnc2ccc(Br)cc2c1Nc1ccc(F)c(F)c1.
What is the InChIKey of 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine?
The InChIKey is BSNOZKOXKDKLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrF2N3/c16-8-1-4-14-10(5-8)15(13(19)7-20-14)21-9-2-3-11(17)12(18)6-9/h1-7H,19H2,(H,20,21).
What are the key properties of 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine?
6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine has a molecular weight of 350.17 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-N-(3,4-difluorophenyl)quinoline-3,4-diamine is sourced from PubChem (CID 43621240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).