C15H10Br2FN3 — CID 104775577
6-bromo-4-N-(3-bromo-4-fluorophenyl)quinoline-3,4-diamine (PubChem CID 104775577) has the molecular formula C15H10Br2FN3 and a molecular weight of 411.07 g/mol. Its IUPAC name is 6-bromo-4-N-(3-bromo-4-fluorophenyl)quinoline-3,4-diamine.
| Compound Name | 6-bromo-4-N-(3-bromo-4-fluorophenyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 104775577 |
| Molecular Formula | C15H10Br2FN3 |
| Molecular Weight | 411.07 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | 6-bromo-4-N-(3-bromo-4-fluorophenyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccc(Br)cc2c1Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H10Br2FN3/c16-8-1-4-14-10(5-8)15(13(19)7-20-14)21-9-2-3-12(18)11(17)6-9/h1-7H,19H2,(H,20,21) |
| InChIKey | WXXRSMPYFOTWLR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.07 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |