C11H6Br3FN2 — CID 104778643
3,5-dibromo-N-(3-bromo-4-fluorophenyl)pyridin-2-amine (PubChem CID 104778643) has the molecular formula C11H6Br3FN2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-bromo-4-fluorophenyl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(3-bromo-4-fluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 104778643 |
| Molecular Formula | C11H6Br3FN2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 421.81 |
| IUPAC Name | 3,5-dibromo-N-(3-bromo-4-fluorophenyl)pyridin-2-amine |
| SMILES | Fc1ccc(Nc2ncc(Br)cc2Br)cc1Br |
| InChI | InChI=1S/C11H6Br3FN2/c12-6-3-9(14)11(16-5-6)17-7-1-2-10(15)8(13)4-7/h1-5H,(H,16,17) |
| InChIKey | KRSLQORCGHAUOW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |