C11H5Br2F3N2 — CID 113413846
3,5-dibromo-N-(2,4,6-trifluorophenyl)pyridin-2-amine (PubChem CID 113413846) has the molecular formula C11H5Br2F3N2 and a molecular weight of 381.98 g/mol. Its IUPAC name is 3,5-dibromo-N-(2,4,6-trifluorophenyl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(2,4,6-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 113413846 |
| Molecular Formula | C11H5Br2F3N2 |
| Molecular Weight | 381.98 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | 3,5-dibromo-N-(2,4,6-trifluorophenyl)pyridin-2-amine |
| SMILES | Fc1cc(F)c(Nc2ncc(Br)cc2Br)c(F)c1 |
| InChI | InChI=1S/C11H5Br2F3N2/c12-5-1-7(13)11(17-4-5)18-10-8(15)2-6(14)3-9(10)16/h1-4H,(H,17,18) |
| InChIKey | KAQDTAHMZFSSMB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |