C14H14Br2N2 — CID 114250505
3,5-dibromo-N-(4-ethyl-3-methylphenyl)pyridin-2-amine (PubChem CID 114250505) has the molecular formula C14H14Br2N2 and a molecular weight of 370.09 g/mol. Its IUPAC name is 3,5-dibromo-N-(4-ethyl-3-methylphenyl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(4-ethyl-3-methylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114250505 |
| Molecular Formula | C14H14Br2N2 |
| Molecular Weight | 370.09 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 3,5-dibromo-N-(4-ethyl-3-methylphenyl)pyridin-2-amine |
| SMILES | CCc1ccc(Nc2ncc(Br)cc2Br)cc1C |
| InChI | InChI=1S/C14H14Br2N2/c1-3-10-4-5-12(6-9(10)2)18-14-13(16)7-11(15)8-17-14/h4-8H,3H2,1-2H3,(H,17,18) |
| InChIKey | PCKVBOJQCWRTKJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.09 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |