C13H17BrN4 — CID 43621177
6-bromo-4-N-[2-(dimethylamino)ethyl]quinoline-3,4-diamine (PubChem CID 43621177) has the molecular formula C13H17BrN4 and a molecular weight of 309.21 g/mol. Its IUPAC name is 6-bromo-4-N-[2-(dimethylamino)ethyl]quinoline-3,4-diamine.
| Compound Name | 6-bromo-4-N-[2-(dimethylamino)ethyl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 43621177 |
| Molecular Formula | C13H17BrN4 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-bromo-4-N-[2-(dimethylamino)ethyl]quinoline-3,4-diamine |
| SMILES | CN(C)CCNc1c(N)cnc2ccc(Br)cc12 |
| InChI | InChI=1S/C13H17BrN4/c1-18(2)6-5-16-13-10-7-9(14)3-4-12(10)17-8-11(13)15/h3-4,7-8H,5-6,15H2,1-2H3,(H,16,17) |
| InChIKey | PLZFGZADUBSVTO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |