C17H22BrN3 — CID 106007171
6-bromo-4-N-(3-cyclopentylpropyl)quinoline-3,4-diamine (PubChem CID 106007171) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 6-bromo-4-N-(3-cyclopentylpropyl)quinoline-3,4-diamine.
| Compound Name | 6-bromo-4-N-(3-cyclopentylpropyl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 106007171 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 6-bromo-4-N-(3-cyclopentylpropyl)quinoline-3,4-diamine |
| SMILES | Nc1cnc2ccc(Br)cc2c1NCCCC1CCCC1 |
| InChI | InChI=1S/C17H22BrN3/c18-13-7-8-16-14(10-13)17(15(19)11-21-16)20-9-3-6-12-4-1-2-5-12/h7-8,10-12H,1-6,9,19H2,(H,20,21) |
| InChIKey | ICRPHHOEVVJQOS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|