C22H16FN3O2 — CID 155734841
4-[5-amino-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]benzoic acid (PubChem CID 155734841) has the molecular formula C22H16FN3O2 and a molecular weight of 373.39 g/mol. Its IUPAC name is 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]benzoic acid.
| Compound Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155734841 |
| Molecular Formula | C22H16FN3O2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[5-amino-1-(4-fluorophenyl)-6-methanimidoylindol-3-yl]benzoic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1ccc(C(=O)O)cc1)cn2-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FN3O2/c23-16-5-7-17(8-6-16)26-12-19(13-1-3-14(4-2-13)22(27)28)18-10-20(25)15(11-24)9-21(18)26/h1-12,24H,25H2,(H,27,28)/b24-11+ |
| InChIKey | YUWLFDPMXAUVRU-BHGWPJFGSA-N |
| XLogP | 4.71 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|