C22H17FN4O3 — CID 178011975
4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-oxo-2H-quinoxalin-1-yl]benzoic acid (PubChem CID 178011975) has the molecular formula C22H17FN4O3 and a molecular weight of 404.40 g/mol. Its IUPAC name is 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-oxo-2H-quinoxalin-1-yl]benzoic acid.
| Compound Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-oxo-2H-quinoxalin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 178011975 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-oxo-2H-quinoxalin-1-yl]benzoic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)N(c1ccc(C(=O)O)cc1)CC(=O)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O3/c23-15-3-7-17(8-4-15)27-20-9-14(11-24)18(25)10-19(20)26(12-21(27)28)16-5-1-13(2-6-16)22(29)30/h1-11,24H,12,25H2,(H,29,30)/b24-11+ |
| InChIKey | SZQLIKLEPMRGQK-BHGWPJFGSA-N |
| XLogP | 3.92 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|