C25H25FN4O — CID 178011962
1-(4-fluorophenyl)-7-methanimidoyl-4-(4-methylphenyl)spiro[3H-quinoxaline-2,3'-oxolane]-6-amine (PubChem CID 178011962) has the molecular formula C25H25FN4O and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-7-methanimidoyl-4-(4-methylphenyl)spiro[3H-quinoxaline-2,3'-oxolane]-6-amine.
| Compound Name | 1-(4-fluorophenyl)-7-methanimidoyl-4-(4-methylphenyl)spiro[3H-quinoxaline-2,3'-oxolane]-6-amine |
|---|---|
| PubChem CID | 178011962 |
| Molecular Formula | C25H25FN4O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(4-fluorophenyl)-7-methanimidoyl-4-(4-methylphenyl)spiro[3H-quinoxaline-2,3'-oxolane]-6-amine |
| SMILES | [H]/N=C/c1cc2c(cc1N)N(c1ccc(C)cc1)CC1(CCOC1)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FN4O/c1-17-2-6-20(7-3-17)29-15-25(10-11-31-16-25)30(21-8-4-19(26)5-9-21)24-12-18(14-27)22(28)13-23(24)29/h2-9,12-14,27H,10-11,15-16,28H2,1H3/b27-14+ |
| InChIKey | DYSWUZWAZBLCMM-MZJWZYIUSA-N |
| XLogP | 5.16 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|