C24H23FN4O2 — CID 178012169
4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-2,2-dimethyl-3H-quinoxalin-1-yl]benzoic acid (PubChem CID 178012169) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-2,2-dimethyl-3H-quinoxalin-1-yl]benzoic acid.
| Compound Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-2,2-dimethyl-3H-quinoxalin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 178012169 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-2,2-dimethyl-3H-quinoxalin-1-yl]benzoic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)N(c1ccc(C(=O)O)cc1)C(C)(C)CN2c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN4O2/c1-24(2)14-28(18-9-5-17(25)6-10-18)21-11-16(13-26)20(27)12-22(21)29(24)19-7-3-15(4-8-19)23(30)31/h3-13,26H,14,27H2,1-2H3,(H,30,31)/b26-13+ |
| InChIKey | BFIQJMWTMQMQKL-LGJNPRDNSA-N |
| XLogP | 5.17 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|