C27H24FN3O3 — CID 166783450
4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]-3-methoxybenzoic acid (PubChem CID 166783450) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]-3-methoxybenzoic acid.
| Compound Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 166783450 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]-3-methoxybenzoic acid |
| SMILES | [H]/N=C/c1cc2c(-c3ccc(F)cc3)c(C(C)C)c(-c3ccc(C(=O)O)cc3OC)nc2cc1N |
| InChI | InChI=1S/C27H24FN3O3/c1-14(2)24-25(15-4-7-18(28)8-5-15)20-10-17(13-29)21(30)12-22(20)31-26(24)19-9-6-16(27(32)33)11-23(19)34-3/h4-14,29H,30H2,1-3H3,(H,32,33)/b29-13+ |
| InChIKey | QWSYGPOTRJLJDG-VFLNYLIXSA-N |
| XLogP | 6.12 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|