C26H23FN4O — CID 166783153
4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]benzamide (PubChem CID 166783153) has the molecular formula C26H23FN4O and a molecular weight of 426.50 g/mol. Its IUPAC name is 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]benzamide.
| Compound Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 166783153 |
| Molecular Formula | C26H23FN4O |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-propan-2-ylquinolin-2-yl]benzamide |
| SMILES | [H]/N=C/c1cc2c(-c3ccc(F)cc3)c(C(C)C)c(-c3ccc(C(N)=O)cc3)nc2cc1N |
| InChI | InChI=1S/C26H23FN4O/c1-14(2)23-24(15-7-9-19(27)10-8-15)20-11-18(13-28)21(29)12-22(20)31-25(23)16-3-5-17(6-4-16)26(30)32/h3-14,28H,29H2,1-2H3,(H2,30,32)/b28-13+ |
| InChIKey | ZHNGDAAHYAARSR-XODNFHPESA-N |
| XLogP | 5.51 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|