C26H24FN3O2 — CID 155734761
2-[3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]phenyl]acetic acid (PubChem CID 155734761) has the molecular formula C26H24FN3O2 and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-[3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 155734761 |
| Molecular Formula | C26H24FN3O2 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[3-[5-amino-1-(4-fluorophenyl)-6-methanimidoyl-2-propan-2-ylindol-3-yl]phenyl]acetic acid |
| SMILES | [H]/N=C/c1cc2c(cc1N)c(-c1cccc(CC(=O)O)c1)c(C(C)C)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3O2/c1-15(2)26-25(17-5-3-4-16(10-17)11-24(31)32)21-13-22(29)18(14-28)12-23(21)30(26)20-8-6-19(27)7-9-20/h3-10,12-15,28H,11,29H2,1-2H3,(H,31,32)/b28-14+ |
| InChIKey | LRPHPXUECCOKNA-CCVNUDIWSA-N |
| XLogP | 5.77 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|