C23H20FN5O2 — CID 155734547
4-[2-amino-5-(4-fluorophenyl)-3-methanimidoyl-6-propan-2-ylpyrrolo[2,3-b]pyrazin-7-yl]benzoic acid (PubChem CID 155734547) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 4-[2-amino-5-(4-fluorophenyl)-3-methanimidoyl-6-propan-2-ylpyrrolo[2,3-b]pyrazin-7-yl]benzoic acid.
| Compound Name | 4-[2-amino-5-(4-fluorophenyl)-3-methanimidoyl-6-propan-2-ylpyrrolo[2,3-b]pyrazin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 155734547 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-[2-amino-5-(4-fluorophenyl)-3-methanimidoyl-6-propan-2-ylpyrrolo[2,3-b]pyrazin-7-yl]benzoic acid |
| SMILES | [H]/N=C/c1nc2c(nc1N)c(-c1ccc(C(=O)O)cc1)c(C(C)C)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FN5O2/c1-12(2)20-18(13-3-5-14(6-4-13)23(30)31)19-22(27-17(11-25)21(26)28-19)29(20)16-9-7-15(24)8-10-16/h3-12,25H,1-2H3,(H2,26,28)(H,30,31)/b25-11+ |
| InChIKey | BXYGTTYIZGOTAG-OPEKNORGSA-N |
| XLogP | 4.63 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|