C29H27F2N3O4 — CID 171072318
4-[5-amino-4-fluoro-1-(4-fluorophenyl)-2-(1-hydroxy-2-methoxycyclohexyl)-6-methanimidoylindol-3-yl]benzoic acid (PubChem CID 171072318) has the molecular formula C29H27F2N3O4 and a molecular weight of 519.55 g/mol. Its IUPAC name is 4-[5-amino-4-fluoro-1-(4-fluorophenyl)-2-(1-hydroxy-2-methoxycyclohexyl)-6-methanimidoylindol-3-yl]benzoic acid.
| Compound Name | 4-[5-amino-4-fluoro-1-(4-fluorophenyl)-2-(1-hydroxy-2-methoxycyclohexyl)-6-methanimidoylindol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 171072318 |
| Molecular Formula | C29H27F2N3O4 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 4-[5-amino-4-fluoro-1-(4-fluorophenyl)-2-(1-hydroxy-2-methoxycyclohexyl)-6-methanimidoylindol-3-yl]benzoic acid |
| SMILES | [H]/N=C/c1cc2c(c(F)c1N)c(-c1ccc(C(=O)O)cc1)c(C1(O)CCCCC1OC)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H27F2N3O4/c1-38-22-4-2-3-13-29(22,37)27-23(16-5-7-17(8-6-16)28(35)36)24-21(14-18(15-32)26(33)25(24)31)34(27)20-11-9-19(30)10-12-20/h5-12,14-15,22,32,37H,2-4,13,33H2,1H3,(H,35,36)/b32-15+ |
| InChIKey | ZZYNUDOUADAXHS-VWJSQJICSA-N |
| XLogP | 5.63 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|