C24H22FN5 — CID 178012041
4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3,3-dimethyl-2H-quinoxalin-1-yl]benzonitrile (PubChem CID 178012041) has the molecular formula C24H22FN5 and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3,3-dimethyl-2H-quinoxalin-1-yl]benzonitrile.
| Compound Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3,3-dimethyl-2H-quinoxalin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 178012041 |
| Molecular Formula | C24H22FN5 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3,3-dimethyl-2H-quinoxalin-1-yl]benzonitrile |
| SMILES | [H]/N=C/c1cc2c(cc1N)N(c1ccc(C#N)cc1)CC(C)(C)N2c1ccc(F)cc1 |
| InChI | InChI=1S/C24H22FN5/c1-24(2)15-29(19-7-3-16(13-26)4-8-19)22-12-21(28)17(14-27)11-23(22)30(24)20-9-5-18(25)6-10-20/h3-12,14,27H,15,28H2,1-2H3/b27-14+ |
| InChIKey | LWALVZGJPYSGJX-MZJWZYIUSA-N |
| XLogP | 5.35 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|