C25H20F2N4O4 — CID 178012072
4-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,6-dimethyl-1,7-dihydropyrazolo[4,3-g]quinoxalin-8-yl]benzoic acid (PubChem CID 178012072) has the molecular formula C25H20F2N4O4 and a molecular weight of 478.46 g/mol. Its IUPAC name is 4-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,6-dimethyl-1,7-dihydropyrazolo[4,3-g]quinoxalin-8-yl]benzoic acid.
| Compound Name | 4-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,6-dimethyl-1,7-dihydropyrazolo[4,3-g]quinoxalin-8-yl]benzoic acid |
|---|---|
| PubChem CID | 178012072 |
| Molecular Formula | C25H20F2N4O4 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-6,6-dimethyl-1,7-dihydropyrazolo[4,3-g]quinoxalin-8-yl]benzoic acid |
| SMILES | CC1(C)CN(c2ccc(C(=O)O)cc2)c2cc3[nH]ncc3cc2N1c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C25H20F2N4O4/c1-24(2)13-30(16-5-3-14(4-6-16)23(32)33)19-11-18-15(12-28-29-18)9-20(19)31(24)17-7-8-21-22(10-17)35-25(26,27)34-21/h3-12H,13H2,1-2H3,(H,28,29)(H,32,33) |
| InChIKey | RUHGOAZEEWIMRC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |